C22H33NO4 — CID 98194442
N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3,4,5-triethoxybenzamide (PubChem CID 98194442) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 98194442 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N[C@@H](C)[C@@H]2C[C@@H]3CC[C@@H]2C3)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H33NO4/c1-5-25-19-12-17(13-20(26-6-2)21(19)27-7-3)22(24)23-14(4)18-11-15-8-9-16(18)10-15/h12-16,18H,5-11H2,1-4H3,(H,23,24)/t14-,15+,16+,18-/m0/s1 |
| InChIKey | WCECWPCLDCUPKK-LHHMISFZSA-N |
| XLogP | 4.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |