C27H27N3O3 — CID 98197188
(1R,9S,13S)-N-(2,4-dimethylphenyl)-9-methyl-10-(2-methylphenyl)-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide (PubChem CID 98197188) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is (1R,9S,13S)-N-(2,4-dimethylphenyl)-9-methyl-10-(2-methylphenyl)-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-N-(2,4-dimethylphenyl)-9-methyl-10-(2-methylphenyl)-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
|---|---|
| PubChem CID | 98197188 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (1R,9S,13S)-N-(2,4-dimethylphenyl)-9-methyl-10-(2-methylphenyl)-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@H]3NC(=O)N(c4ccccc4C)[C@@]2(C)Oc2ccccc23)c(C)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-16-13-14-20(18(3)15-16)28-25(31)23-24-19-10-6-8-12-22(19)33-27(23,4)30(26(32)29-24)21-11-7-5-9-17(21)2/h5-15,23-24H,1-4H3,(H,28,31)(H,29,32)/t23-,24+,27+/m1/s1 |
| InChIKey | YJWJKGCDYMEKKK-DXBVXKBHSA-N |
| XLogP | 5.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |