C17H13N3O4 — CID 98198424
(3aS,6aS)-5-(4-methoxyphenyl)-3-pyridin-3-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98198424) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is (3aS,6aS)-5-(4-methoxyphenyl)-3-pyridin-3-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aS)-5-(4-methoxyphenyl)-3-pyridin-3-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98198424 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (3aS,6aS)-5-(4-methoxyphenyl)-3-pyridin-3-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3C(c4cccnc4)=NO[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C17H13N3O4/c1-23-12-6-4-11(5-7-12)20-16(21)13-14(10-3-2-8-18-9-10)19-24-15(13)17(20)22/h2-9,13,15H,1H3/t13-,15-/m0/s1 |
| InChIKey | GWYALUDMANGAQH-ZFWWWQNUSA-N |
| XLogP | 1.38 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|