C24H20N2O8S — CID 98199416
methyl 3-[(1S,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-4-methoxybenzoate (PubChem CID 98199416) has the molecular formula C24H20N2O8S and a molecular weight of 496.50 g/mol. Its IUPAC name is methyl 3-[(1S,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-4-methoxybenzoate.
| Compound Name | methyl 3-[(1S,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 98199416 |
| Molecular Formula | C24H20N2O8S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | methyl 3-[(1S,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(N2C(=O)[C@H]3[C@@H]4C(=C(N)S[C@H]3C2=O)C(=O)Oc2c(OC)cccc24)c1 |
| InChI | InChI=1S/C24H20N2O8S/c1-31-13-8-7-10(23(29)33-3)9-12(13)26-21(27)16-15-11-5-4-6-14(32-2)18(11)34-24(30)17(15)20(25)35-19(16)22(26)28/h4-9,15-16,19H,25H2,1-3H3/t15-,16+,19-/m1/s1 |
| InChIKey | ZUXBWOKXELQEJF-JTDSTZFVSA-N |
| XLogP | 1.97 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|