About (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol
(5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol (PubChem CID 98199437) has the molecular formula C24H18ClN3O2
and a molecular weight of 415.88 g/mol. Its IUPAC name is (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol.
Molecular Properties
| Compound Name | (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol |
| PubChem CID | 98199437 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol |
| SMILES | [H]/N=c1/c2c(ncn1Cc1ccccc1)Oc1cc(O)ccc1[C@H]2c1ccccc1Cl |
| InChI | InChI=1S/C24H18ClN3O2/c25-19-9-5-4-8-17(19)21-18-11-10-16(29)12-20(18)30-24-22(21)23(26)28(14-27-24)13-15-6-2-1-3-7-15/h1-12,14,21,26,29H,13H2/b26-23-/t21-/m1/s1 |
| InChIKey | HZAWMLFAFGMAEU-IHNLPELVSA-N |
| XLogP | 5.06 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The IUPAC name of (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol (CID 98199437) is (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol.
What is the SMILES notation for (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The canonical SMILES for (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol is [H]/N=c1/c2c(ncn1Cc1ccccc1)Oc1cc(O)ccc1[C@H]2c1ccccc1Cl.
What is the InChIKey of (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The InChIKey is HZAWMLFAFGMAEU-IHNLPELVSA-N. The full InChI is InChI=1S/C24H18ClN3O2/c25-19-9-5-4-8-17(19)21-18-11-10-16(29)12-20(18)30-24-22(21)23(26)28(14-27-24)13-15-6-2-1-3-7-15/h1-12,14,21,26,29H,13H2/b26-23-/t21-/m1/s1.
What are the key properties of (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
(5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol has a molecular weight of 415.88 g/mol, XLogP of 5.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-benzyl-5-(2-chlorophenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol is sourced from PubChem (CID 98199437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).