C20H21ClO4 — CID 98199952
7-O-[(2-chlorophenyl)methyl] 6-O-ethyl (1R,2S,4S,5R,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate (PubChem CID 98199952) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is 7-O-[(2-chlorophenyl)methyl] 6-O-ethyl (1R,2S,4S,5R,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate.
| Compound Name | 7-O-[(2-chlorophenyl)methyl] 6-O-ethyl (1R,2S,4S,5R,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 98199952 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 7-O-[(2-chlorophenyl)methyl] 6-O-ethyl (1R,2S,4S,5R,6R,7S)-tricyclo[3.2.2.02,4]non-8-ene-6,7-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C=C[C@H]([C@H]3C[C@H]23)[C@@H]1C(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C20H21ClO4/c1-2-24-19(22)17-12-7-8-13(15-9-14(12)15)18(17)20(23)25-10-11-5-3-4-6-16(11)21/h3-8,12-15,17-18H,2,9-10H2,1H3/t12-,13-,14-,15-,17-,18+/m1/s1 |
| InChIKey | LEKQGMYPEPSLTE-GBALJZQLSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|