C22H16N2O6S — CID 98201298
methyl 2-[(1S,13S,17R)-11-amino-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraen-15-yl]benzoate (PubChem CID 98201298) has the molecular formula C22H16N2O6S and a molecular weight of 436.45 g/mol. Its IUPAC name is methyl 2-[(1S,13S,17R)-11-amino-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraen-15-yl]benzoate.
| Compound Name | methyl 2-[(1S,13S,17R)-11-amino-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraen-15-yl]benzoate |
|---|---|
| PubChem CID | 98201298 |
| Molecular Formula | C22H16N2O6S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | methyl 2-[(1S,13S,17R)-11-amino-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraen-15-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@@H]2[C@H](SC(N)=C3C(=O)Oc4ccccc4[C@@H]32)C1=O |
| InChI | InChI=1S/C22H16N2O6S/c1-29-21(27)10-6-2-4-8-12(10)24-19(25)15-14-11-7-3-5-9-13(11)30-22(28)16(14)18(23)31-17(15)20(24)26/h2-9,14-15,17H,23H2,1H3/t14-,15+,17+/m1/s1 |
| InChIKey | VDJYLKBQDGNOHS-VYDXJSESSA-N |
| XLogP | 1.95 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|