C20H17N3O3 — CID 98201350
N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]indolizine-2-carboxamide (PubChem CID 98201350) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]indolizine-2-carboxamide.
| Compound Name | N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 98201350 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-[[(3R)-2,5-dioxopyrrolidin-3-yl]methyl]phenyl]indolizine-2-carboxamide |
| SMILES | O=C1C[C@@H](Cc2ccc(NC(=O)c3cc4ccccn4c3)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H17N3O3/c24-18-11-14(19(25)22-18)9-13-4-6-16(7-5-13)21-20(26)15-10-17-3-1-2-8-23(17)12-15/h1-8,10,12,14H,9,11H2,(H,21,26)(H,22,24,25)/t14-/m1/s1 |
| InChIKey | PYNJSPJJKRRNSV-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|