C16H24N4O4S — CID 98201549
ethyl 5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxycarbonylamino]thiadiazole-4-carboxylate (PubChem CID 98201549) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is ethyl 5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxycarbonylamino]thiadiazole-4-carboxylate.
| Compound Name | ethyl 5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxycarbonylamino]thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 98201549 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl 5-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxycarbonylamino]thiadiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnsc1NC(=O)OC[C@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C16H24N4O4S/c1-2-23-15(21)13-14(25-19-18-13)17-16(22)24-10-11-6-5-9-20-8-4-3-7-12(11)20/h11-12H,2-10H2,1H3,(H,17,22)/t11-,12-/m1/s1 |
| InChIKey | XCUBYCZGMXVMHV-VXGBXAGGSA-N |
| XLogP | 2.53 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |