C23H17F8N3OS — CID 98202734
(3R)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(1,1,2,2,3,3,4,4-octafluorobutyl)-5-phenyl-4H-pyrazol-3-ol (PubChem CID 98202734) has the molecular formula C23H17F8N3OS and a molecular weight of 535.46 g/mol. Its IUPAC name is (3R)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(1,1,2,2,3,3,4,4-octafluorobutyl)-5-phenyl-4H-pyrazol-3-ol.
| Compound Name | (3R)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(1,1,2,2,3,3,4,4-octafluorobutyl)-5-phenyl-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 98202734 |
| Molecular Formula | C23H17F8N3OS |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (3R)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(1,1,2,2,3,3,4,4-octafluorobutyl)-5-phenyl-4H-pyrazol-3-ol |
| SMILES | Cc1ccc(-c2csc(N3N=C(c4ccccc4)C[C@@]3(O)C(F)(F)C(F)(F)C(F)(F)C(F)F)n2)cc1 |
| InChI | InChI=1S/C23H17F8N3OS/c1-13-7-9-15(10-8-13)17-12-36-19(32-17)34-20(35,11-16(33-34)14-5-3-2-4-6-14)22(28,29)23(30,31)21(26,27)18(24)25/h2-10,12,18,35H,11H2,1H3/t20-/m1/s1 |
| InChIKey | UPXOPWREKGQNDR-HXUWFJFHSA-N |
| XLogP | 6.59 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|