C19H18ClNO2 — CID 98204395
(1S,2R,6R,7S)-4-(5-chloro-2-methylphenyl)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98204395) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-(5-chloro-2-methylphenyl)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-4-(5-chloro-2-methylphenyl)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98204395 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (1S,2R,6R,7S)-4-(5-chloro-2-methylphenyl)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)=C1[C@H]2C=C[C@H]1[C@H]1C(=O)N(c3cc(Cl)ccc3C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H18ClNO2/c1-9(2)15-12-6-7-13(15)17-16(12)18(22)21(19(17)23)14-8-11(20)5-4-10(14)3/h4-8,12-13,16-17H,1-3H3/t12-,13-,16-,17-/m1/s1 |
| InChIKey | LGKLVUFOKKZNPJ-BQGCOEIASA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|