C25H25N3O3S2 — CID 98205971
methyl (5R)-7-methyl-3-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-5-thiophen-3-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98205971) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is methyl (5R)-7-methyl-3-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-5-thiophen-3-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (5R)-7-methyl-3-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-5-thiophen-3-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98205971 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | methyl (5R)-7-methyl-3-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]-5-thiophen-3-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C2SC=C(CC(=O)N[C@@H]3CCCc4ccccc43)N2[C@H]1c1ccsc1 |
| InChI | InChI=1S/C25H25N3O3S2/c1-15-22(24(30)31-2)23(17-10-11-32-13-17)28-18(14-33-25(28)26-15)12-21(29)27-20-9-5-7-16-6-3-4-8-19(16)20/h3-4,6,8,10-11,13-14,20,23H,5,7,9,12H2,1-2H3,(H,27,29)/t20-,23+/m1/s1 |
| InChIKey | XIPRWGWABUWWIJ-OFNKIYASSA-N |
| XLogP | 5.08 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |