C23H18N2O7S — CID 98206875
4-[(1S,13R,17R)-11-amino-6-ethoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]benzoic acid (PubChem CID 98206875) has the molecular formula C23H18N2O7S and a molecular weight of 466.47 g/mol. Its IUPAC name is 4-[(1S,13R,17R)-11-amino-6-ethoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]benzoic acid.
| Compound Name | 4-[(1S,13R,17R)-11-amino-6-ethoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]benzoic acid |
|---|---|
| PubChem CID | 98206875 |
| Molecular Formula | C23H18N2O7S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-[(1S,13R,17R)-11-amino-6-ethoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]benzoic acid |
| SMILES | CCOc1cccc2c1OC(=O)C1=C(N)S[C@H]3C(=O)N(c4ccc(C(=O)O)cc4)C(=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C23H18N2O7S/c1-2-31-13-5-3-4-12-14-15-18(33-19(24)16(14)23(30)32-17(12)13)21(27)25(20(15)26)11-8-6-10(7-9-11)22(28)29/h3-9,14-15,18H,2,24H2,1H3,(H,28,29)/t14-,15+,18-/m1/s1 |
| InChIKey | NOPICRHNQQHTLG-RVKKMQEKSA-N |
| XLogP | 2.26 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|