C26H35FN4OS — CID 98208343
2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 98208343) has the molecular formula C26H35FN4OS and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 98208343 |
| Molecular Formula | C26H35FN4OS |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2C(=O)CSc2nnc(-c3ccccc3F)n2C2CCCCC2)C1 |
| InChI | InChI=1S/C26H35FN4OS/c1-25(2)13-19-14-26(3,16-25)17-30(19)22(32)15-33-24-29-28-23(20-11-7-8-12-21(20)27)31(24)18-9-5-4-6-10-18/h7-8,11-12,18-19H,4-6,9-10,13-17H2,1-3H3/t19-,26+/m0/s1 |
| InChIKey | PFABMVSTQVRECP-AFMDSPMNSA-N |
| XLogP | 6.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |