C22H22N4O4 — CID 98208541
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide (PubChem CID 98208541) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide |
|---|---|
| PubChem CID | 98208541 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide |
| SMILES | Cc1c(NC(=O)CN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H22N4O4/c1-12-19(22(30)26(24(12)2)15-6-4-3-5-7-15)23-16(27)11-25-20(28)17-13-8-9-14(10-13)18(17)21(25)29/h3-9,13-14,17-18H,10-11H2,1-2H3,(H,23,27)/t13-,14-,17-,18+/m0/s1 |
| InChIKey | LMYFLDVHXZRLDE-DFEHZGFQSA-N |
| XLogP | 1.23 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|