C26H33N3O3 — CID 98210873
2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[2-[[(3R,5R)-3,5-dimethyl-1-adamantyl]oxy]ethyl]acetamide (PubChem CID 98210873) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[2-[[(3R,5R)-3,5-dimethyl-1-adamantyl]oxy]ethyl]acetamide.
| Compound Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[2-[[(3R,5R)-3,5-dimethyl-1-adamantyl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 98210873 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-(4H-chromeno[3,4-d]pyrazol-1-yl)-N-[2-[[(3R,5R)-3,5-dimethyl-1-adamantyl]oxy]ethyl]acetamide |
| SMILES | C[C@]12CC3CC(OCCNC(=O)Cn4ncc5c4-c4ccccc4OC5)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C26H33N3O3/c1-24-9-18-10-25(2,15-24)17-26(11-18,16-24)32-8-7-27-22(30)13-29-23-19(12-28-29)14-31-21-6-4-3-5-20(21)23/h3-6,12,18H,7-11,13-17H2,1-2H3,(H,27,30)/t18?,24-,25-,26?/m1/s1 |
| InChIKey | FHKBRUYZZVLQLB-VFNQFOGHSA-N |
| XLogP | 4.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|