C12H13F3N2O — CID 98211448
(Z)-4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-one (PubChem CID 98211448) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is (Z)-4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 98211448 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (Z)-4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
| SMILES | CN(C)N/C(=C\C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H13F3N2O/c1-17(2)16-10(8-11(18)12(13,14)15)9-6-4-3-5-7-9/h3-8,16H,1-2H3/b10-8- |
| InChIKey | MQBGPCSZMOCVRI-NTMALXAHSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|