C31H30N2O3 — CID 98214557
(2R)-N-benzyl-2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,3-diphenylpropanamide (PubChem CID 98214557) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2R)-N-benzyl-2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,3-diphenylpropanamide.
| Compound Name | (2R)-N-benzyl-2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 98214557 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (2R)-N-benzyl-2-[(1S,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N,3-diphenylpropanamide |
| SMILES | O=C([C@@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C1=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c34-29(32(25-14-8-3-9-15-25)20-22-12-6-2-7-13-22)26(18-21-10-4-1-5-11-21)33-30(35)27-23-16-17-24(19-23)28(27)31(33)36/h1-15,23-24,26-28H,16-20H2/t23-,24-,26+,27-,28+/m0/s1 |
| InChIKey | IJFLTCOGBKFTSX-YJKNTMTJSA-N |
| XLogP | 4.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|