C16H13Br2ClN2O3 — CID 98214634
4-chloro-N-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide (PubChem CID 98214634) has the molecular formula C16H13Br2ClN2O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide.
| Compound Name | 4-chloro-N-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
|---|---|
| PubChem CID | 98214634 |
| Molecular Formula | C16H13Br2ClN2O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 473.90 |
| IUPAC Name | 4-chloro-N-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
| SMILES | O=C(NN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13Br2ClN2O3/c17-12-8-5-9(13(12)18)11-10(8)15(23)21(16(11)24)20-14(22)6-1-3-7(19)4-2-6/h1-4,8-13H,5H2,(H,20,22)/t8-,9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | ZYYJIDIYDXXGHG-PTEOKISQSA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|