C14H17N3O3 — CID 98215452
(1R,6R)-N'-(4-nitrophenyl)bicyclo[4.1.0]heptane-7-carbohydrazide (PubChem CID 98215452) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (1R,6R)-N'-(4-nitrophenyl)bicyclo[4.1.0]heptane-7-carbohydrazide.
| Compound Name | (1R,6R)-N'-(4-nitrophenyl)bicyclo[4.1.0]heptane-7-carbohydrazide |
|---|---|
| PubChem CID | 98215452 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (1R,6R)-N'-(4-nitrophenyl)bicyclo[4.1.0]heptane-7-carbohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1)C1[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C14H17N3O3/c18-14(13-11-3-1-2-4-12(11)13)16-15-9-5-7-10(8-6-9)17(19)20/h5-8,11-13,15H,1-4H2,(H,16,18)/t11-,12-/m1/s1 |
| InChIKey | PSMOGSNQNUFBEU-VXGBXAGGSA-N |
| XLogP | 2.47 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|