C20H27N3O2 — CID 98215544
(4R)-4-(4-hydroxyphenyl)-3-methyl-5-octyl-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 98215544) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (4R)-4-(4-hydroxyphenyl)-3-methyl-5-octyl-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | (4R)-4-(4-hydroxyphenyl)-3-methyl-5-octyl-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 98215544 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (4R)-4-(4-hydroxyphenyl)-3-methyl-5-octyl-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | CCCCCCCCN1C(=O)c2n[nH]c(C)c2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-3-4-5-6-7-8-13-23-19(15-9-11-16(24)12-10-15)17-14(2)21-22-18(17)20(23)25/h9-12,19,24H,3-8,13H2,1-2H3,(H,21,22)/t19-/m1/s1 |
| InChIKey | VCVKHYZTYGCUFI-LJQANCHMSA-N |
| XLogP | 4.33 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|