C19H24N4 — CID 98220438
(1S)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(4,5-dimethyl-1,2,4-triazol-3-yl)-1-phenylmethanamine (PubChem CID 98220438) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (1S)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(4,5-dimethyl-1,2,4-triazol-3-yl)-1-phenylmethanamine.
| Compound Name | (1S)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(4,5-dimethyl-1,2,4-triazol-3-yl)-1-phenylmethanamine |
|---|---|
| PubChem CID | 98220438 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1S)-N-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(4,5-dimethyl-1,2,4-triazol-3-yl)-1-phenylmethanamine |
| SMILES | Cc1nnc([C@@H](NC[C@H]2C[C@H]3C=C[C@H]2C3)c2ccccc2)n1C |
| InChI | InChI=1S/C19H24N4/c1-13-21-22-19(23(13)2)18(15-6-4-3-5-7-15)20-12-17-11-14-8-9-16(17)10-14/h3-9,14,16-18,20H,10-12H2,1-2H3/t14-,16-,17+,18-/m0/s1 |
| InChIKey | FYNPVLIMTMLPGO-OWLYRPNTSA-N |
| XLogP | 3.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|