C17H26N4 — CID 98220456
(1S)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropan-1-amine (PubChem CID 98220456) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is (1S)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropan-1-amine.
| Compound Name | (1S)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 98220456 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | (1S)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropan-1-amine |
| SMILES | CC(C)[C@H](NC[C@@H]1C[C@H]2C=C[C@H]1C2)c1nnc2n1CCC2 |
| InChI | InChI=1S/C17H26N4/c1-11(2)16(17-20-19-15-4-3-7-21(15)17)18-10-14-9-12-5-6-13(14)8-12/h5-6,11-14,16,18H,3-4,7-10H2,1-2H3/t12-,13-,14-,16-/m0/s1 |
| InChIKey | MCJNKSXKPUOTGY-YXWQFLTLSA-N |
| XLogP | 2.72 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|