C15H25NO2S — CID 98220516
cis-(1S,3R)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-methylsulfonylcyclohexan-1-amine (PubChem CID 98220516) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is cis-(1S,3R)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-methylsulfonylcyclohexan-1-amine.
| Compound Name | cis-(1S,3R)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 98220516 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | cis-(1S,3R)-N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-3-methylsulfonylcyclohexan-1-amine |
| SMILES | CS(=O)(=O)[C@@H]1CCC[C@H](NC[C@@H]2C[C@H]3C=C[C@H]2C3)C1 |
| InChI | InChI=1S/C15H25NO2S/c1-19(17,18)15-4-2-3-14(9-15)16-10-13-8-11-5-6-12(13)7-11/h5-6,11-16H,2-4,7-10H2,1H3/t11-,12-,13-,14-,15+/m0/s1 |
| InChIKey | CKGJMCSSMKUERO-YYFQZIEXSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|