About (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol
(3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol (PubChem CID 98220520) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol |
| PubChem CID | 98220520 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol |
| SMILES | CSC[C@@H](CCO)NC[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H23NOS/c1-16-9-13(4-5-15)14-8-12-7-10-2-3-11(12)6-10/h2-3,10-15H,4-9H2,1H3/t10-,11-,12-,13+/m0/s1 |
| InChIKey | FMKCBMDGFUEGMX-ZDEQEGDKSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol?
The IUPAC name of (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol (CID 98220520) is (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol.
What is the SMILES notation for (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol?
The canonical SMILES for (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol is CSC[C@@H](CCO)NC[C@@H]1C[C@H]2C=C[C@H]1C2.
What is the InChIKey of (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol?
The InChIKey is FMKCBMDGFUEGMX-ZDEQEGDKSA-N. The full InChI is InChI=1S/C13H23NOS/c1-16-9-13(4-5-15)14-8-12-7-10-2-3-11(12)6-10/h2-3,10-15H,4-9H2,1H3/t10-,11-,12-,13+/m0/s1.
What are the key properties of (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol?
(3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol has a molecular weight of 241.40 g/mol, XLogP of 1.90, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylamino]-4-methylsulfanylbutan-1-ol is sourced from PubChem (CID 98220520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).