C14H22N4 — CID 98220540
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(3-ethyl-1,2,4-triazol-4-yl)ethanamine (PubChem CID 98220540) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(3-ethyl-1,2,4-triazol-4-yl)ethanamine.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(3-ethyl-1,2,4-triazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 98220540 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(3-ethyl-1,2,4-triazol-4-yl)ethanamine |
| SMILES | CCc1nncn1CCNC[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H22N4/c1-2-14-17-16-10-18(14)6-5-15-9-13-8-11-3-4-12(13)7-11/h3-4,10-13,15H,2,5-9H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | NIOOMRSYZYPXBY-AVGNSLFASA-N |
| XLogP | 1.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|