C18H22N2O3 — CID 98221424
N-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl]cyclopent-3-ene-1-carboxamide (PubChem CID 98221424) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 98221424 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NCCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)C1CC=CC1 |
| InChI | InChI=1S/C18H22N2O3/c21-16(11-4-1-2-5-11)19-8-3-9-20-17(22)14-12-6-7-13(10-12)15(14)18(20)23/h1-2,6-7,11-15H,3-5,8-10H2,(H,19,21)/t12-,13-,14-,15+/m0/s1 |
| InChIKey | CJICLVIFDSFFMB-ZQDZILKHSA-N |
| XLogP | 1.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|