C19H16FN3O2 — CID 98221677
(1R,2S,6S,7R)-4-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98221677) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-4-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98221677 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (1R,2S,6S,7R)-4-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccn(Cc3ccc(F)cc3)n1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C19H16FN3O2/c20-14-5-1-11(2-6-14)10-22-8-7-15(21-22)23-18(24)16-12-3-4-13(9-12)17(16)19(23)25/h1-8,12-13,16-17H,9-10H2/t12-,13-,16-,17-/m0/s1 |
| InChIKey | BWXXZOWKFHTXEC-PYTWLRIVSA-N |
| XLogP | 2.38 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|