C24H18F5N3O3S — CID 98221798
methyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98221798) has the molecular formula C24H18F5N3O3S and a molecular weight of 523.48 g/mol. Its IUPAC name is methyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98221798 |
| Molecular Formula | C24H18F5N3O3S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | methyl (2E,5R)-5-[4-(dimethylamino)phenyl]-7-methyl-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2s/c(=C/c3c(F)c(F)c(F)c(F)c3F)c(=O)n2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H18F5N3O3S/c1-10-15(23(34)35-4)21(11-5-7-12(8-6-11)31(2)3)32-22(33)14(36-24(32)30-10)9-13-16(25)18(27)20(29)19(28)17(13)26/h5-9,21H,1-4H3/b14-9+/t21-/m1/s1 |
| InChIKey | HVLORJSCRYXKHX-ZGQNHIEXSA-N |
| XLogP | 3.17 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|