C14H15N3O5 — CID 98222304
methyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-1-methylpyrazole-5-carboxylate (PubChem CID 98222304) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-1-methylpyrazole-5-carboxylate.
| Compound Name | methyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 98222304 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | methyl 4-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-1-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2CC[C@@H]3O2)cnn1C |
| InChI | InChI=1S/C14H15N3O5/c1-16-11(14(20)21-2)6(5-15-16)17-12(18)9-7-3-4-8(22-7)10(9)13(17)19/h5,7-10H,3-4H2,1-2H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | TXBDLQIHDAPXIX-XKNYDFJKSA-N |
| XLogP | -0.13 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|