C31H28FN5O3 — CID 98224849
(9R)-N-(3,4-dimethoxyphenyl)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 98224849) has the molecular formula C31H28FN5O3 and a molecular weight of 537.60 g/mol. Its IUPAC name is (9R)-N-(3,4-dimethoxyphenyl)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-N-(3,4-dimethoxyphenyl)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 98224849 |
| Molecular Formula | C31H28FN5O3 |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (9R)-N-(3,4-dimethoxyphenyl)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | COc1ccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3[C@H]2c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C31H28FN5O3/c1-20-25-19-36(31(38)33-23-14-15-27(39-2)28(18-23)40-3)29(21-9-7-10-22(32)17-21)26-13-8-16-35(26)30(25)37(34-20)24-11-5-4-6-12-24/h4-18,29H,19H2,1-3H3,(H,33,38)/t29-/m1/s1 |
| InChIKey | DINDWYVGBZATCJ-GDLZYMKVSA-N |
| XLogP | 6.26 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |