C21H25NO2 — CID 98229288
(1R,2S,3R,4R)-N-formyl-3-methyl-N-(2,4,6-trimethylphenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 98229288) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R,2S,3R,4R)-N-formyl-3-methyl-N-(2,4,6-trimethylphenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1R,2S,3R,4R)-N-formyl-3-methyl-N-(2,4,6-trimethylphenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 98229288 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1R,2S,3R,4R)-N-formyl-3-methyl-N-(2,4,6-trimethylphenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | Cc1cc(C)c(N(C=O)C(=O)[C@H]2[C@H](C)[C@H]3C=C[C@H]2C32CC2)c(C)c1 |
| InChI | InChI=1S/C21H25NO2/c1-12-9-13(2)19(14(3)10-12)22(11-23)20(24)18-15(4)16-5-6-17(18)21(16)7-8-21/h5-6,9-11,15-18H,7-8H2,1-4H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | JXZDEUZZIMNDFA-TVFCKZIOSA-N |
| XLogP | 3.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|