C18H10Cl2O3 — CID 98229912
(15R,19R)-1,8-dichloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 98229912) has the molecular formula C18H10Cl2O3 and a molecular weight of 345.18 g/mol. Its IUPAC name is (15R,19R)-1,8-dichloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-1,8-dichloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 98229912 |
| Molecular Formula | C18H10Cl2O3 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (15R,19R)-1,8-dichloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]1C1(Cl)c3ccccc3C2(Cl)c2ccccc21 |
| InChI | InChI=1S/C18H10Cl2O3/c19-17-9-5-1-2-6-10(9)18(20,12-8-4-3-7-11(12)17)14-13(17)15(21)23-16(14)22/h1-8,13-14H/t13-,14-,17?,18?/m1/s1 |
| InChIKey | CTMYKTZXKOHVNC-JDPPGYRCSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|