C29H32N4O4S — CID 98232144
ethyl 2-[[(2S,4Z)-2-methyl-2-pyridin-3-yl-4-[(2,4,6-trimethylphenyl)carbamothioylhydrazinylidene]-3H-chromen-6-yl]oxy]acetate (PubChem CID 98232144) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is ethyl 2-[[(2S,4Z)-2-methyl-2-pyridin-3-yl-4-[(2,4,6-trimethylphenyl)carbamothioylhydrazinylidene]-3H-chromen-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(2S,4Z)-2-methyl-2-pyridin-3-yl-4-[(2,4,6-trimethylphenyl)carbamothioylhydrazinylidene]-3H-chromen-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 98232144 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | ethyl 2-[[(2S,4Z)-2-methyl-2-pyridin-3-yl-4-[(2,4,6-trimethylphenyl)carbamothioylhydrazinylidene]-3H-chromen-6-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)/C(=N\NC(=S)Nc1c(C)cc(C)cc1C)C[C@@](C)(c1cccnc1)O2 |
| InChI | InChI=1S/C29H32N4O4S/c1-6-35-26(34)17-36-22-9-10-25-23(14-22)24(15-29(5,37-25)21-8-7-11-30-16-21)32-33-28(38)31-27-19(3)12-18(2)13-20(27)4/h7-14,16H,6,15,17H2,1-5H3,(H2,31,33,38)/b32-24-/t29-/m0/s1 |
| InChIKey | NUYJJRIZFXKBID-WBMCFFPJSA-N |
| XLogP | 5.34 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|