C18H18N2O2S — CID 98232303
(3aR,7aR)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98232303) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is (3aR,7aR)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98232303 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3aR,7aR)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1sc(N2C(=O)[C@@H]3CCCC[C@H]3C2=O)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-11-15(12-7-3-2-4-8-12)19-18(23-11)20-16(21)13-9-5-6-10-14(13)17(20)22/h2-4,7-8,13-14H,5-6,9-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | MUCIWSNWQQMRAQ-ZIAGYGMSSA-N |
| XLogP | 3.80 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|