About 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole
1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole (PubChem CID 98242190) has the molecular formula C15H18ClFN2O2S
and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole |
| PubChem CID | 98242190 |
| Molecular Formula | C15H18ClFN2O2S |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole |
| SMILES | O=S(=O)(Cc1ccc(F)c(Cl)c1)N1CC[C@H](N2CC=CC2)C1 |
| InChI | InChI=1S/C15H18ClFN2O2S/c16-14-9-12(3-4-15(14)17)11-22(20,21)19-8-5-13(10-19)18-6-1-2-7-18/h1-4,9,13H,5-8,10-11H2/t13-/m0/s1 |
| InChIKey | CHZVNVZKIGWGSS-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole?
The IUPAC name of 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole (CID 98242190) is 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole.
What is the SMILES notation for 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole?
The canonical SMILES for 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole is O=S(=O)(Cc1ccc(F)c(Cl)c1)N1CC[C@H](N2CC=CC2)C1.
What is the InChIKey of 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole?
The InChIKey is CHZVNVZKIGWGSS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H18ClFN2O2S/c16-14-9-12(3-4-15(14)17)11-22(20,21)19-8-5-13(10-19)18-6-1-2-7-18/h1-4,9,13H,5-8,10-11H2/t13-/m0/s1.
What are the key properties of 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole?
1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole has a molecular weight of 344.84 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]pyrrolidin-3-yl]-2,5-dihydropyrrole is sourced from PubChem (CID 98242190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).