C14H21N3O2S — CID 98243637
[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate (PubChem CID 98243637) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is [(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate.
| Compound Name | [(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 98243637 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-(1H-1,2,4-triazol-5-ylsulfanyl)acetate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](OC(=O)CSc1ncn[nH]1)C2 |
| InChI | InChI=1S/C14H21N3O2S/c1-13(2)9-4-5-14(13,3)10(6-9)19-11(18)7-20-12-15-8-16-17-12/h8-10H,4-7H2,1-3H3,(H,15,16,17)/t9-,10-,14-/m0/s1 |
| InChIKey | OWXRBOYBJLUKHW-BHDSKKPTSA-N |
| XLogP | 2.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |