C14H16Br2O2 — CID 98246158
(1R,2S,4S,5S)-2-benzyl-4,5-dibromocyclohexane-1-carboxylic acid (PubChem CID 98246158) has the molecular formula C14H16Br2O2 and a molecular weight of 376.09 g/mol. Its IUPAC name is (1R,2S,4S,5S)-2-benzyl-4,5-dibromocyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,4S,5S)-2-benzyl-4,5-dibromocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 98246158 |
| Molecular Formula | C14H16Br2O2 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | (1R,2S,4S,5S)-2-benzyl-4,5-dibromocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](Br)[C@@H](Br)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H16Br2O2/c15-12-7-10(6-9-4-2-1-3-5-9)11(14(17)18)8-13(12)16/h1-5,10-13H,6-8H2,(H,17,18)/t10-,11+,12-,13-/m0/s1 |
| InChIKey | AAALQQFPMTXRQS-RNJOBUHISA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|