C18H18FNO2 — CID 98250940
(1R,2R,3S,4R)-N-(2-fluorophenyl)-N-formyl-3-methylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 98250940) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is (1R,2R,3S,4R)-N-(2-fluorophenyl)-N-formyl-3-methylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1R,2R,3S,4R)-N-(2-fluorophenyl)-N-formyl-3-methylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 98250940 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1R,2R,3S,4R)-N-(2-fluorophenyl)-N-formyl-3-methylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](C(=O)N(C=O)c2ccccc2F)[C@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C18H18FNO2/c1-11-12-6-7-13(18(12)8-9-18)16(11)17(22)20(10-21)15-5-3-2-4-14(15)19/h2-7,10-13,16H,8-9H2,1H3/t11-,12+,13+,16+/m0/s1 |
| InChIKey | QFOGUNLOKPEKEF-VPWBDBDCSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|