C26H27NO3 — CID 98256447
(1R,2R,6S,7R)-2-methyl-4-[4-(5-methyl-2-propan-2-ylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98256447) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (1R,2R,6S,7R)-2-methyl-4-[4-(5-methyl-2-propan-2-ylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-2-methyl-4-[4-(5-methyl-2-propan-2-ylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98256447 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (1R,2R,6S,7R)-2-methyl-4-[4-(5-methyl-2-propan-2-ylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccc(C(C)C)c(Oc2ccc(N3C(=O)[C@H]4[C@H]5C=C[C@@H](C5)[C@@]4(C)C3=O)cc2)c1 |
| InChI | InChI=1S/C26H27NO3/c1-15(2)21-12-5-16(3)13-22(21)30-20-10-8-19(9-11-20)27-24(28)23-17-6-7-18(14-17)26(23,4)25(27)29/h5-13,15,17-18,23H,14H2,1-4H3/t17-,18-,23+,26+/m0/s1 |
| InChIKey | XOJMJVWDKKIYTI-HZVHMGPLSA-N |
| XLogP | 5.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|