About 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine
6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine (PubChem CID 98260186) has the molecular formula C16H19BrN4
and a molecular weight of 347.26 g/mol. Its IUPAC name is 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine |
| PubChem CID | 98260186 |
| Molecular Formula | C16H19BrN4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine |
| SMILES | Brc1ccc2ncc(CN3CC[C@H](N4CC=CC4)C3)n2c1 |
| InChI | InChI=1S/C16H19BrN4/c17-13-3-4-16-18-9-15(21(16)10-13)12-19-8-5-14(11-19)20-6-1-2-7-20/h1-4,9-10,14H,5-8,11-12H2/t14-/m0/s1 |
| InChIKey | ASRGRXPWEWUFNC-AWEZNQCLSA-N |
| XLogP | 2.54 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine (CID 98260186) is 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine is Brc1ccc2ncc(CN3CC[C@H](N4CC=CC4)C3)n2c1.
What is the InChIKey of 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine?
The InChIKey is ASRGRXPWEWUFNC-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H19BrN4/c17-13-3-4-16-18-9-15(21(16)10-13)12-19-8-5-14(11-19)20-6-1-2-7-20/h1-4,9-10,14H,5-8,11-12H2/t14-/m0/s1.
What are the key properties of 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine?
6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine has a molecular weight of 347.26 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[[(3S)-3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]methyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 98260186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).