C20H26O5 — CID 98261507
ethyl (3R,4R)-4-[(2S)-1-(2,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate (PubChem CID 98261507) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is ethyl (3R,4R)-4-[(2S)-1-(2,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-[(2S)-1-(2,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 98261507 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | ethyl (3R,4R)-4-[(2S)-1-(2,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)OC(C)(C)[C@@H]1[C@H](C)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C20H26O5/c1-7-24-18(22)15-16(20(5,6)25-19(15)23)13(4)17(21)14-9-8-11(2)10-12(14)3/h8-10,13,15-16H,7H2,1-6H3/t13-,15+,16+/m0/s1 |
| InChIKey | BMEYCXVAQSYVPR-NUEKZKHPSA-N |
| XLogP | 3.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|