C21H36N2O3 — CID 98262293
[(3R,5R)-3,5-dimethyl-1-adamantyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 98262293) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(3R,5R)-3,5-dimethyl-1-adamantyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | [(3R,5R)-3,5-dimethyl-1-adamantyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98262293 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | [(3R,5R)-3,5-dimethyl-1-adamantyl]-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | C[C@]12CC3CC(C(=O)N4CCN(CCOCCO)CC4)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C21H36N2O3/c1-19-11-17-12-20(2,14-19)16-21(13-17,15-19)18(25)23-5-3-22(4-6-23)7-9-26-10-8-24/h17,24H,3-16H2,1-2H3/t17?,19-,20-,21?/m1/s1 |
| InChIKey | APTIOMBBOBOKQG-ODKCFSPTSA-N |
| XLogP | 2.14 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|