C28H26N2O3S — CID 982641
4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-(2-phenylphenyl)benzamide (PubChem CID 982641) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-(2-phenylphenyl)benzamide.
| Compound Name | 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-(2-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 982641 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-(2-phenylphenyl)benzamide |
| SMILES | Cc1ccc(CN(c2ccc(C(=O)Nc3ccccc3-c3ccccc3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H26N2O3S/c1-21-12-14-22(15-13-21)20-30(34(2,32)33)25-18-16-24(17-19-25)28(31)29-27-11-7-6-10-26(27)23-8-4-3-5-9-23/h3-19H,20H2,1-2H3,(H,29,31) |
| InChIKey | NBZRYHVCTURQAJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |