C22H23N3O2 — CID 98265924
2-[(3aR)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 98265924) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-[(3aR)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(3aR)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 98265924 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[(3aR)-4-oxo-1,2,3,3a-tetrahydrocyclopenta[c][1,5]benzodiazepin-5-yl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)[C@@H]3CCCC3=Nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-10-11-17(15(2)12-14)24-21(26)13-25-20-9-4-3-7-19(20)23-18-8-5-6-16(18)22(25)27/h3-4,7,9-12,16H,5-6,8,13H2,1-2H3,(H,24,26)/t16-/m1/s1 |
| InChIKey | OSVFFRVEUYDSDV-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |