C20H20Cl2N4S — CID 982701
12-[4-(3,4-dichlorophenyl)piperazin-1-yl]-10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 982701) has the molecular formula C20H20Cl2N4S and a molecular weight of 419.38 g/mol. Its IUPAC name is 12-[4-(3,4-dichlorophenyl)piperazin-1-yl]-10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[4-(3,4-dichlorophenyl)piperazin-1-yl]-10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 982701 |
| Molecular Formula | C20H20Cl2N4S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 12-[4-(3,4-dichlorophenyl)piperazin-1-yl]-10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Cc1nc(N2CCN(c3ccc(Cl)c(Cl)c3)CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C20H20Cl2N4S/c1-12-23-19(18-14-3-2-4-17(14)27-20(18)24-12)26-9-7-25(8-10-26)13-5-6-15(21)16(22)11-13/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | CIURZBIFJYTSRF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |