C15H25NO2 — CID 98272555
[(1S,2S,5S,8R)-2-piperidin-1-yl-8-bicyclo[3.2.1]octanyl] acetate (PubChem CID 98272555) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is [(1S,2S,5S,8R)-2-piperidin-1-yl-8-bicyclo[3.2.1]octanyl] acetate.
| Compound Name | [(1S,2S,5S,8R)-2-piperidin-1-yl-8-bicyclo[3.2.1]octanyl] acetate |
|---|---|
| PubChem CID | 98272555 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | [(1S,2S,5S,8R)-2-piperidin-1-yl-8-bicyclo[3.2.1]octanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2CC[C@H]1[C@@H](N1CCCCC1)CC2 |
| InChI | InChI=1S/C15H25NO2/c1-11(17)18-15-12-5-7-13(15)14(8-6-12)16-9-3-2-4-10-16/h12-15H,2-10H2,1H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | WAAWXHBKTWLHRM-ZQDZILKHSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |