C13H12F3N3O3 — CID 98273632
(3aR,4S,7S,7aR)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98273632) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aR)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98273632 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (3aR,4S,7S,7aR)-2-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1[nH]nc(C(F)(F)F)c1N1C(=O)[C@@H]2[C@@H](C1=O)[C@@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C13H12F3N3O3/c1-4-9(10(18-17-4)13(14,15)16)19-11(20)7-5-2-3-6(22-5)8(7)12(19)21/h5-8H,2-3H2,1H3,(H,17,18)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | CZHIZGLGSAHFDL-XAMCCFCMSA-N |
| XLogP | 1.40 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|