C22H27N5O3 — CID 98273936
(2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pentanamide (PubChem CID 98273936) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pentanamide.
| Compound Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 98273936 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-methyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]pentanamide |
| SMILES | CC(C)C[C@H](C(=O)NCCc1nnc2ccccn12)N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C22H27N5O3/c1-14(2)13-17(27-21(29)15-7-3-4-8-16(15)22(27)30)20(28)23-11-10-19-25-24-18-9-5-6-12-26(18)19/h3-6,9,12,14-17H,7-8,10-11,13H2,1-2H3,(H,23,28)/t15-,16+,17-/m1/s1 |
| InChIKey | PJFJQQDCVTUZFX-IXDOHACOSA-N |
| XLogP | 1.75 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|