C31H23N3O6S — CID 98275117
(2E,5S)-6-acetyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 98275117) has the molecular formula C31H23N3O6S and a molecular weight of 565.61 g/mol. Its IUPAC name is (2E,5S)-6-acetyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | (2E,5S)-6-acetyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 98275117 |
| Molecular Formula | C31H23N3O6S |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (2E,5S)-6-acetyl-5-(2-methoxynaphthalen-1-yl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | COc1ccc2ccccc2c1[C@H]1C(C(C)=O)=C(C)N=c2s/c(=C/c3ccc(-c4cccc([N+](=O)[O-])c4)o3)c(=O)n21 |
| InChI | InChI=1S/C31H23N3O6S/c1-17-27(18(2)35)29(28-23-10-5-4-7-19(23)11-13-25(28)39-3)33-30(36)26(41-31(33)32-17)16-22-12-14-24(40-22)20-8-6-9-21(15-20)34(37)38/h4-16,29H,1-3H3/b26-16+/t29-/m1/s1 |
| InChIKey | KVWUUTQTCWSKMS-YIECNSLDSA-N |
| XLogP | 5.15 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|